About 2-fluoroethyl 2-hydroxybenzoate
2-fluoroethyl 2-hydroxybenzoate (PubChem CID 158044446) has the molecular formula C9H9FO3
and a molecular weight of 184.17 g/mol. Its IUPAC name is 2-fluoroethyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-fluoroethyl 2-hydroxybenzoate |
| PubChem CID | 158044446 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-fluoroethyl 2-hydroxybenzoate |
| SMILES | O=C(OCCF)c1ccccc1O |
| InChI | InChI=1S/C9H9FO3/c10-5-6-13-9(12)7-3-1-2-4-8(7)11/h1-4,11H,5-6H2 |
| InChIKey | BAZFQBCEFLQIAD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoroethyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 2-hydroxybenzoate?
The IUPAC name of 2-fluoroethyl 2-hydroxybenzoate (CID 158044446) is 2-fluoroethyl 2-hydroxybenzoate.
What is the SMILES notation for 2-fluoroethyl 2-hydroxybenzoate?
The canonical SMILES for 2-fluoroethyl 2-hydroxybenzoate is O=C(OCCF)c1ccccc1O.
What is the InChIKey of 2-fluoroethyl 2-hydroxybenzoate?
The InChIKey is BAZFQBCEFLQIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO3/c10-5-6-13-9(12)7-3-1-2-4-8(7)11/h1-4,11H,5-6H2.
What are the key properties of 2-fluoroethyl 2-hydroxybenzoate?
2-fluoroethyl 2-hydroxybenzoate has a molecular weight of 184.17 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 2-hydroxybenzoate is sourced from PubChem (CID 158044446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).