About ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane
ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane (PubChem CID 159507892) has the molecular formula C18H22O6
and a molecular weight of 334.37 g/mol. Its IUPAC name is ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane.
Molecular Properties
| Compound Name | ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane |
| PubChem CID | 159507892 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane |
| SMILES | C.CC.O=C(OCOC(=O)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C15H12O6.C2H6.CH4/c16-12-7-3-1-5-10(12)14(18)20-9-21-15(19)11-6-2-4-8-13(11)17;1-2;/h1-8,16-17H,9H2;1-2H3;1H4 |
| InChIKey | MAFOFWWXIKPDES-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane?
The IUPAC name of ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane (CID 159507892) is ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane.
What is the SMILES notation for ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane?
The canonical SMILES for ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane is C.CC.O=C(OCOC(=O)c1ccccc1O)c1ccccc1O.
What is the InChIKey of ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane?
The InChIKey is MAFOFWWXIKPDES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O6.C2H6.CH4/c16-12-7-3-1-5-10(12)14(18)20-9-21-15(19)11-6-2-4-8-13(11)17;1-2;/h1-8,16-17H,9H2;1-2H3;1H4.
What are the key properties of ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane?
ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane has a molecular weight of 334.37 g/mol, XLogP of 3.73, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-hydroxybenzoyl)oxymethyl 2-hydroxybenzoate;methane is sourced from PubChem (CID 159507892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).