About 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride
3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride (PubChem CID 3051498) has the molecular formula C18H28ClNO2
and a molecular weight of 325.88 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride |
| PubChem CID | 3051498 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride |
| SMILES | CC1CCCCN1CCCOC(=O)CCc1ccccc1.Cl |
| InChI | InChI=1S/C18H27NO2.ClH/c1-16-8-5-6-13-19(16)14-7-15-21-18(20)12-11-17-9-3-2-4-10-17;/h2-4,9-10,16H,5-8,11-15H2,1H3;1H |
| InChIKey | DNQBDDFMCDCNHQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride?
The IUPAC name of 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride (CID 3051498) is 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride.
What is the SMILES notation for 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride?
The canonical SMILES for 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride is CC1CCCCN1CCCOC(=O)CCc1ccccc1.Cl.
What is the InChIKey of 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride?
The InChIKey is DNQBDDFMCDCNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO2.ClH/c1-16-8-5-6-13-19(16)14-7-15-21-18(20)12-11-17-9-3-2-4-10-17;/h2-4,9-10,16H,5-8,11-15H2,1H3;1H.
What are the key properties of 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride?
3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride has a molecular weight of 325.88 g/mol, XLogP of 3.85, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpiperidin-1-yl)propyl 3-phenylpropanoate;hydrochloride is sourced from PubChem (CID 3051498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).