C23H28ClNO3 — CID 138401134
3-(2-methylpiperidin-1-yl)propyl 2-benzoylbenzoate;hydrochloride (PubChem CID 138401134) has the molecular formula C23H28ClNO3 and a molecular weight of 401.93 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)propyl 2-benzoylbenzoate;hydrochloride.
| Compound Name | 3-(2-methylpiperidin-1-yl)propyl 2-benzoylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 138401134 |
| Molecular Formula | C23H28ClNO3 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)propyl 2-benzoylbenzoate;hydrochloride |
| SMILES | CC1CCCCN1CCCOC(=O)c1ccccc1C(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C23H27NO3.ClH/c1-18-10-7-8-15-24(18)16-9-17-27-23(26)21-14-6-5-13-20(21)22(25)19-11-3-2-4-12-19;/h2-6,11-14,18H,7-10,15-17H2,1H3;1H |
| InChIKey | GNNXZUUDKRWEKH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|