C29H35N2O3S+ — CID 67441878
2-(2-acetamido-3-tritylsulfanylpropanoyl)oxyethyl-trimethylazanium (PubChem CID 67441878) has the molecular formula C29H35N2O3S+ and a molecular weight of 491.68 g/mol. Its IUPAC name is 2-(2-acetamido-3-tritylsulfanylpropanoyl)oxyethyl-trimethylazanium.
| Compound Name | 2-(2-acetamido-3-tritylsulfanylpropanoyl)oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 67441878 |
| Molecular Formula | C29H35N2O3S+ |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-(2-acetamido-3-tritylsulfanylpropanoyl)oxyethyl-trimethylazanium |
| SMILES | CC(=O)NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C29H34N2O3S/c1-23(32)30-27(28(33)34-21-20-31(2,3)4)22-35-29(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,27H,20-22H2,1-4H3/p+1 |
| InChIKey | ZPZOEKKDIDIUMV-UHFFFAOYSA-O |
| XLogP | 4.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|