C28H31NO3S — CID 167031344
2-methylpropyl 2-acetamido-3-tritylsulfanylpropanoate (PubChem CID 167031344) has the molecular formula C28H31NO3S and a molecular weight of 461.63 g/mol. Its IUPAC name is 2-methylpropyl 2-acetamido-3-tritylsulfanylpropanoate.
| Compound Name | 2-methylpropyl 2-acetamido-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 167031344 |
| Molecular Formula | C28H31NO3S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-methylpropyl 2-acetamido-3-tritylsulfanylpropanoate |
| SMILES | CC(=O)NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC(C)C |
| InChI | InChI=1S/C28H31NO3S/c1-21(2)19-32-27(31)26(29-22(3)30)20-33-28(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,21,26H,19-20H2,1-3H3,(H,29,30) |
| InChIKey | KWKIRNLBUZCYLK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|