C33H40N6O5S — CID 175774195
(2R)-2-[[(2R)-2-[[(2S)-2-acetamido-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 175774195) has the molecular formula C33H40N6O5S and a molecular weight of 632.79 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 175774195 |
| Molecular Formula | C33H40N6O5S |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-3-tritylsulfanylpropanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(=O)N[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N[C@H](C)C(=O)N[C@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C33H40N6O5S/c1-22(29(41)39-27(31(43)44)19-12-20-36-32(34)35)37-30(42)28(38-23(2)40)21-45-33(24-13-6-3-7-14-24,25-15-8-4-9-16-25)26-17-10-5-11-18-26/h3-11,13-18,22,27-28H,12,19-21H2,1-2H3,(H,37,42)(H,38,40)(H,39,41)(H,43,44)(H4,34,35,36)/t22-,27-,28-/m1/s1 |
| InChIKey | ONJJNMDANXYJEB-MWVDVNALSA-N |
| XLogP | 2.34 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|