C20H32N6O3 — CID 167095807
(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-phenylpropan-2-yl]pentanamide (PubChem CID 167095807) has the molecular formula C20H32N6O3 and a molecular weight of 404.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-phenylpropan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-phenylpropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 167095807 |
| Molecular Formula | C20H32N6O3 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-phenylpropan-2-yl]pentanamide |
| SMILES | CC(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C20H32N6O3/c1-13(12-16-8-5-4-6-9-16)24-19(29)17(10-7-11-23-20(21)22)26-18(28)14(2)25-15(3)27/h4-6,8-9,13-14,17H,7,10-12H2,1-3H3,(H,24,29)(H,25,27)(H,26,28)(H4,21,22,23)/t13-,14-,17-/m0/s1 |
| InChIKey | YJBYKTIERHQNTJ-ZQIUZPCESA-N |
| XLogP | -0.20 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|