C18H28N4O2 — CID 148772507
N-[(7R)-1-(diaminomethylideneamino)-7-methyl-5-oxo-8-phenyloctan-4-yl]acetamide (PubChem CID 148772507) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[(7R)-1-(diaminomethylideneamino)-7-methyl-5-oxo-8-phenyloctan-4-yl]acetamide.
| Compound Name | N-[(7R)-1-(diaminomethylideneamino)-7-methyl-5-oxo-8-phenyloctan-4-yl]acetamide |
|---|---|
| PubChem CID | 148772507 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-[(7R)-1-(diaminomethylideneamino)-7-methyl-5-oxo-8-phenyloctan-4-yl]acetamide |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)C[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C18H28N4O2/c1-13(11-15-7-4-3-5-8-15)12-17(24)16(22-14(2)23)9-6-10-21-18(19)20/h3-5,7-8,13,16H,6,9-12H2,1-2H3,(H,22,23)(H4,19,20,21)/t13-,16?/m1/s1 |
| InChIKey | OIRKPCZKUCFBJT-JBZHPUCOSA-N |
| XLogP | 1.38 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|