C22H33N3O3 — CID 165105516
N-[(2S,5S)-10-amino-10-imino-2-methyl-4-oxo-1-phenyldecan-5-yl]-4-oxopentanamide (PubChem CID 165105516) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-[(2S,5S)-10-amino-10-imino-2-methyl-4-oxo-1-phenyldecan-5-yl]-4-oxopentanamide.
| Compound Name | N-[(2S,5S)-10-amino-10-imino-2-methyl-4-oxo-1-phenyldecan-5-yl]-4-oxopentanamide |
|---|---|
| PubChem CID | 165105516 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | N-[(2S,5S)-10-amino-10-imino-2-methyl-4-oxo-1-phenyldecan-5-yl]-4-oxopentanamide |
| SMILES | [H]/N=C(\N)CCCC[C@H](NC(=O)CCC(C)=O)C(=O)C[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C22H33N3O3/c1-16(14-18-8-4-3-5-9-18)15-20(27)19(10-6-7-11-21(23)24)25-22(28)13-12-17(2)26/h3-5,8-9,16,19H,6-7,10-15H2,1-2H3,(H3,23,24)(H,25,28)/t16-,19-/m0/s1 |
| InChIKey | ZBBZGZROTOHNGN-LPHOPBHVSA-N |
| XLogP | 3.17 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|