C18H30N2O — CID 157392358
(2S,5S)-2-methyl-5,9-bis(methylamino)-1-phenylnonan-4-one (PubChem CID 157392358) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (2S,5S)-2-methyl-5,9-bis(methylamino)-1-phenylnonan-4-one.
| Compound Name | (2S,5S)-2-methyl-5,9-bis(methylamino)-1-phenylnonan-4-one |
|---|---|
| PubChem CID | 157392358 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (2S,5S)-2-methyl-5,9-bis(methylamino)-1-phenylnonan-4-one |
| SMILES | CNCCCC[C@H](NC)C(=O)C[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C18H30N2O/c1-15(13-16-9-5-4-6-10-16)14-18(21)17(20-3)11-7-8-12-19-2/h4-6,9-10,15,17,19-20H,7-8,11-14H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | OZFDPRHJVTXVRV-RDJZCZTQSA-N |
| XLogP | 2.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|