C16H28N3O+ — CID 142547448
[(5S)-5-(methylamino)-6-oxo-6-[[(2S)-1-phenylpropan-2-yl]amino]hexyl]azanium (PubChem CID 142547448) has the molecular formula C16H28N3O+ and a molecular weight of 278.42 g/mol. Its IUPAC name is [(5S)-5-(methylamino)-6-oxo-6-[[(2S)-1-phenylpropan-2-yl]amino]hexyl]azanium.
| Compound Name | [(5S)-5-(methylamino)-6-oxo-6-[[(2S)-1-phenylpropan-2-yl]amino]hexyl]azanium |
|---|---|
| PubChem CID | 142547448 |
| Molecular Formula | C16H28N3O+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | [(5S)-5-(methylamino)-6-oxo-6-[[(2S)-1-phenylpropan-2-yl]amino]hexyl]azanium |
| SMILES | CN[C@@H](CCCC[NH3+])C(=O)N[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C16H27N3O/c1-13(12-14-8-4-3-5-9-14)19-16(20)15(18-2)10-6-7-11-17/h3-5,8-9,13,15,18H,6-7,10-12,17H2,1-2H3,(H,19,20)/p+1/t13-,15-/m0/s1 |
| InChIKey | CTWPCRCOKPHHPS-ZFWWWQNUSA-O |
| XLogP | 0.73 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|