C15H26N3O+ — CID 156803632
[(2S)-6-amino-1-oxo-1-[[(2R)-1-phenylpropan-2-yl]amino]hexan-2-yl]azanium (PubChem CID 156803632) has the molecular formula C15H26N3O+ and a molecular weight of 264.39 g/mol. Its IUPAC name is [(2S)-6-amino-1-oxo-1-[[(2R)-1-phenylpropan-2-yl]amino]hexan-2-yl]azanium.
| Compound Name | [(2S)-6-amino-1-oxo-1-[[(2R)-1-phenylpropan-2-yl]amino]hexan-2-yl]azanium |
|---|---|
| PubChem CID | 156803632 |
| Molecular Formula | C15H26N3O+ |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | [(2S)-6-amino-1-oxo-1-[[(2R)-1-phenylpropan-2-yl]amino]hexan-2-yl]azanium |
| SMILES | C[C@H](Cc1ccccc1)NC(=O)[C@@H]([NH3+])CCCCN |
| InChI | InChI=1S/C15H25N3O/c1-12(11-13-7-3-2-4-8-13)18-15(19)14(17)9-5-6-10-16/h2-4,7-8,12,14H,5-6,9-11,16-17H2,1H3,(H,18,19)/p+1/t12-,14+/m1/s1 |
| InChIKey | VOBHXZCDAVEXEY-OCCSQVGLSA-O |
| XLogP | 0.47 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|