C30H45N5O3 — CID 145185953
N-(6-aminohexan-2-yl)-2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanamide (PubChem CID 145185953) has the molecular formula C30H45N5O3 and a molecular weight of 523.72 g/mol. Its IUPAC name is N-(6-aminohexan-2-yl)-2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanamide.
| Compound Name | N-(6-aminohexan-2-yl)-2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 145185953 |
| Molecular Formula | C30H45N5O3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | N-(6-aminohexan-2-yl)-2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1ccccc1)C(=O)NC(C)CCCCN |
| InChI | InChI=1S/C30H45N5O3/c1-21(2)18-26(29(37)33-22(3)12-10-11-17-31)35-30(38)27(20-24-15-8-5-9-16-24)34-28(36)25(32)19-23-13-6-4-7-14-23/h4-9,13-16,21-22,25-27H,10-12,17-20,31-32H2,1-3H3,(H,33,37)(H,34,36)(H,35,38) |
| InChIKey | PURSOSDNOBFEMC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|