C19H39N3O2 — CID 163648641
(7S)-2-methyl-7,11-bis(methylamino)-4-[4-(methylamino)butyl]undecane-3,6-dione (PubChem CID 163648641) has the molecular formula C19H39N3O2 and a molecular weight of 341.54 g/mol. Its IUPAC name is (7S)-2-methyl-7,11-bis(methylamino)-4-[4-(methylamino)butyl]undecane-3,6-dione.
| Compound Name | (7S)-2-methyl-7,11-bis(methylamino)-4-[4-(methylamino)butyl]undecane-3,6-dione |
|---|---|
| PubChem CID | 163648641 |
| Molecular Formula | C19H39N3O2 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.30 |
| IUPAC Name | (7S)-2-methyl-7,11-bis(methylamino)-4-[4-(methylamino)butyl]undecane-3,6-dione |
| SMILES | CNCCCCC(CC(=O)[C@H](CCCCNC)NC)C(=O)C(C)C |
| InChI | InChI=1S/C19H39N3O2/c1-15(2)19(24)16(10-6-8-12-20-3)14-18(23)17(22-5)11-7-9-13-21-4/h15-17,20-22H,6-14H2,1-5H3/t16?,17-/m0/s1 |
| InChIKey | VAPVZYAJXPVKEU-DJNXLDHESA-N |
| XLogP | 2.15 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|