C24H48N4O3 — CID 166897489
N-[5-(methylamino)-6-[[2-methyl-8-(methylamino)-3-oxooctan-4-yl]amino]-6-oxohexyl]heptanamide (PubChem CID 166897489) has the molecular formula C24H48N4O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is N-[5-(methylamino)-6-[[2-methyl-8-(methylamino)-3-oxooctan-4-yl]amino]-6-oxohexyl]heptanamide.
| Compound Name | N-[5-(methylamino)-6-[[2-methyl-8-(methylamino)-3-oxooctan-4-yl]amino]-6-oxohexyl]heptanamide |
|---|---|
| PubChem CID | 166897489 |
| Molecular Formula | C24H48N4O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | N-[5-(methylamino)-6-[[2-methyl-8-(methylamino)-3-oxooctan-4-yl]amino]-6-oxohexyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCCCC(NC)C(=O)NC(CCCCNC)C(=O)C(C)C |
| InChI | InChI=1S/C24H48N4O3/c1-6-7-8-9-16-22(29)27-18-13-11-15-21(26-5)24(31)28-20(23(30)19(2)3)14-10-12-17-25-4/h19-21,25-26H,6-18H2,1-5H3,(H,27,29)(H,28,31) |
| InChIKey | KBBQJDANMYUTLM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|