C40H77N3O4 — CID 161155649
6-methyl-N-[5-(6-methylheptanoylamino)-12-(6-methylheptylamino)-8-(2-methylpropanoyl)-6-oxododecyl]heptanamide (PubChem CID 161155649) has the molecular formula C40H77N3O4 and a molecular weight of 664.07 g/mol. Its IUPAC name is 6-methyl-N-[5-(6-methylheptanoylamino)-12-(6-methylheptylamino)-8-(2-methylpropanoyl)-6-oxododecyl]heptanamide.
| Compound Name | 6-methyl-N-[5-(6-methylheptanoylamino)-12-(6-methylheptylamino)-8-(2-methylpropanoyl)-6-oxododecyl]heptanamide |
|---|---|
| PubChem CID | 161155649 |
| Molecular Formula | C40H77N3O4 |
| Molecular Weight | 664.07 g/mol |
| Exact Mass | 663.59 |
| IUPAC Name | 6-methyl-N-[5-(6-methylheptanoylamino)-12-(6-methylheptylamino)-8-(2-methylpropanoyl)-6-oxododecyl]heptanamide |
| SMILES | CC(C)CCCCCNCCCCC(CC(=O)C(CCCCNC(=O)CCCCC(C)C)NC(=O)CCCCC(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C40H77N3O4/c1-31(2)20-10-9-17-27-41-28-18-15-23-35(40(47)34(7)8)30-37(44)36(43-39(46)26-14-12-22-33(5)6)24-16-19-29-42-38(45)25-13-11-21-32(3)4/h31-36,41H,9-30H2,1-8H3,(H,42,45)(H,43,46) |
| InChIKey | ZIPOIYDJKNNXML-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.07 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|