tert-butyl 2,6-bis(methylamino)hexanoate

C12H26N2O2 — CID 59397454

IUPACtert-butyl 2,6-bis(methylamino)hexanoate
SMILESCNCCCCC(NC)C(=O)OC(C)(C)C
InChIInChI=1S/C12H26N2O2/c1-12(2,3)16-11(15)10(14-5)8-6-7-9-13-4/h10,13-14H,6-9H2,1-5H3
InChIKeyNQIJEEQBEAYMNO-UHFFFAOYSA-N
MW230.35 g/mol
LogP1.31
Rot. Bonds7

About tert-butyl 2,6-bis(methylamino)hexanoate

tert-butyl 2,6-bis(methylamino)hexanoate (PubChem CID 59397454) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is tert-butyl 2,6-bis(methylamino)hexanoate.

Molecular Properties

Compound Nametert-butyl 2,6-bis(methylamino)hexanoate
PubChem CID59397454
Molecular FormulaC12H26N2O2
Molecular Weight230.35 g/mol
Exact Mass230.20
IUPAC Nametert-butyl 2,6-bis(methylamino)hexanoate
SMILESCNCCCCC(NC)C(=O)OC(C)(C)C
InChIInChI=1S/C12H26N2O2/c1-12(2,3)16-11(15)10(14-5)8-6-7-9-13-4/h10,13-14H,6-9H2,1-5H3
InChIKeyNQIJEEQBEAYMNO-UHFFFAOYSA-N
XLogP1.31
TPSA50.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.35
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze tert-butyl 2,6-bis(methylamino)hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,6-bis(methylamino)hexanoate?
The IUPAC name of tert-butyl 2,6-bis(methylamino)hexanoate (CID 59397454) is tert-butyl 2,6-bis(methylamino)hexanoate.
What is the SMILES notation for tert-butyl 2,6-bis(methylamino)hexanoate?
The canonical SMILES for tert-butyl 2,6-bis(methylamino)hexanoate is CNCCCCC(NC)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2,6-bis(methylamino)hexanoate?
The InChIKey is NQIJEEQBEAYMNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O2/c1-12(2,3)16-11(15)10(14-5)8-6-7-9-13-4/h10,13-14H,6-9H2,1-5H3.
What are the key properties of tert-butyl 2,6-bis(methylamino)hexanoate?
tert-butyl 2,6-bis(methylamino)hexanoate has a molecular weight of 230.35 g/mol, XLogP of 1.31, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,6-bis(methylamino)hexanoate is sourced from PubChem (CID 59397454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).