C9H20N2O — CID 153084375
N,2-dimethyl-6-(methylamino)hexanamide (PubChem CID 153084375) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N,2-dimethyl-6-(methylamino)hexanamide.
| Compound Name | N,2-dimethyl-6-(methylamino)hexanamide |
|---|---|
| PubChem CID | 153084375 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N,2-dimethyl-6-(methylamino)hexanamide |
| SMILES | CNCCCCC(C)C(=O)NC |
| InChI | InChI=1S/C9H20N2O/c1-8(9(12)11-3)6-4-5-7-10-2/h8,10H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | VNXGNQFSDXKAPS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|