C7H15N5O3 — CID 89114426
(2S)-N-methyl-2,6-bis(2-oxohydrazinyl)hexanamide (PubChem CID 89114426) has the molecular formula C7H15N5O3 and a molecular weight of 217.23 g/mol. Its IUPAC name is (2S)-N-methyl-2,6-bis(2-oxohydrazinyl)hexanamide.
| Compound Name | (2S)-N-methyl-2,6-bis(2-oxohydrazinyl)hexanamide |
|---|---|
| PubChem CID | 89114426 |
| Molecular Formula | C7H15N5O3 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (2S)-N-methyl-2,6-bis(2-oxohydrazinyl)hexanamide |
| SMILES | CNC(=O)[C@H](CCCCNN=O)NN=O |
| InChI | InChI=1S/C7H15N5O3/c1-8-7(13)6(10-12-15)4-2-3-5-9-11-14/h6H,2-5H2,1H3,(H,8,13)(H,9,14)(H,10,15)/t6-/m0/s1 |
| InChIKey | CVNIVSKZFVOZTB-LURJTMIESA-N |
| XLogP | -0.19 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|