C14H33N3O2 — CID 171511904
2-acetamido-N-methyl-6-(methylamino)hexanamide;ethane (PubChem CID 171511904) has the molecular formula C14H33N3O2 and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-acetamido-N-methyl-6-(methylamino)hexanamide;ethane.
| Compound Name | 2-acetamido-N-methyl-6-(methylamino)hexanamide;ethane |
|---|---|
| PubChem CID | 171511904 |
| Molecular Formula | C14H33N3O2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 2-acetamido-N-methyl-6-(methylamino)hexanamide;ethane |
| SMILES | CC.CC.CNCCCCC(NC(C)=O)C(=O)NC |
| InChI | InChI=1S/C10H21N3O2.2C2H6/c1-8(14)13-9(10(15)12-3)6-4-5-7-11-2;2*1-2/h9,11H,4-7H2,1-3H3,(H,12,15)(H,13,14);2*1-2H3 |
| InChIKey | STBDBUQMQRCYIF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|