C14H25N3O5 — CID 161373398
methyl 4-[[(5S)-5-acetamido-6-(methylamino)-6-oxohexyl]amino]-4-oxobutanoate (PubChem CID 161373398) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 4-[[(5S)-5-acetamido-6-(methylamino)-6-oxohexyl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[[(5S)-5-acetamido-6-(methylamino)-6-oxohexyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 161373398 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | methyl 4-[[(5S)-5-acetamido-6-(methylamino)-6-oxohexyl]amino]-4-oxobutanoate |
| SMILES | CNC(=O)[C@H](CCCCNC(=O)CCC(=O)OC)NC(C)=O |
| InChI | InChI=1S/C14H25N3O5/c1-10(18)17-11(14(21)15-2)6-4-5-9-16-12(19)7-8-13(20)22-3/h11H,4-9H2,1-3H3,(H,15,21)(H,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | VQTKBJOGFBHXMR-NSHDSACASA-N |
| XLogP | -0.52 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|