C13H22N2O5S2 — CID 165351093
(2S)-2-acetamido-6-[(3-methoxy-3-oxopropyl)sulfanylcarbothioylamino]hexanoic acid (PubChem CID 165351093) has the molecular formula C13H22N2O5S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2S)-2-acetamido-6-[(3-methoxy-3-oxopropyl)sulfanylcarbothioylamino]hexanoic acid.
| Compound Name | (2S)-2-acetamido-6-[(3-methoxy-3-oxopropyl)sulfanylcarbothioylamino]hexanoic acid |
|---|---|
| PubChem CID | 165351093 |
| Molecular Formula | C13H22N2O5S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (2S)-2-acetamido-6-[(3-methoxy-3-oxopropyl)sulfanylcarbothioylamino]hexanoic acid |
| SMILES | COC(=O)CCSC(=S)NCCCC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C13H22N2O5S2/c1-9(16)15-10(12(18)19)5-3-4-7-14-13(21)22-8-6-11(17)20-2/h10H,3-8H2,1-2H3,(H,14,21)(H,15,16)(H,18,19)/t10-/m0/s1 |
| InChIKey | GYOCMNRVJNAGQB-JTQLQIEISA-N |
| XLogP | 0.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|