C16H22N2O3S2 — CID 25180078
2-acetamido-3-(4-phenylbutylcarbamothioylsulfanyl)propanoic acid (PubChem CID 25180078) has the molecular formula C16H22N2O3S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-acetamido-3-(4-phenylbutylcarbamothioylsulfanyl)propanoic acid.
| Compound Name | 2-acetamido-3-(4-phenylbutylcarbamothioylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 25180078 |
| Molecular Formula | C16H22N2O3S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-acetamido-3-(4-phenylbutylcarbamothioylsulfanyl)propanoic acid |
| SMILES | CC(=O)NC(CSC(=S)NCCCCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H22N2O3S2/c1-12(19)18-14(15(20)21)11-23-16(22)17-10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8,14H,5-6,9-11H2,1H3,(H,17,22)(H,18,19)(H,20,21) |
| InChIKey | LITKDIAXAOEWHC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|