C12H15NO3S3 — CID 88914982
(2R)-2-acetamido-3-(benzyltrisulfanyl)propanoic acid (PubChem CID 88914982) has the molecular formula C12H15NO3S3 and a molecular weight of 317.46 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(benzyltrisulfanyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(benzyltrisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 88914982 |
| Molecular Formula | C12H15NO3S3 |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | (2R)-2-acetamido-3-(benzyltrisulfanyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CSSSCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H15NO3S3/c1-9(14)13-11(12(15)16)8-18-19-17-7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,13,14)(H,15,16)/t11-/m0/s1 |
| InChIKey | ISEVXRKARFNKFZ-NSHDSACASA-N |
| XLogP | 2.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|