C19H22N2O2S2 — CID 102043629
(2R)-2-acetamido-N-benzyl-3-(benzyldisulfanyl)propanamide (PubChem CID 102043629) has the molecular formula C19H22N2O2S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is (2R)-2-acetamido-N-benzyl-3-(benzyldisulfanyl)propanamide.
| Compound Name | (2R)-2-acetamido-N-benzyl-3-(benzyldisulfanyl)propanamide |
|---|---|
| PubChem CID | 102043629 |
| Molecular Formula | C19H22N2O2S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (2R)-2-acetamido-N-benzyl-3-(benzyldisulfanyl)propanamide |
| SMILES | CC(=O)N[C@@H](CSSCc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O2S2/c1-15(22)21-18(14-25-24-13-17-10-6-3-7-11-17)19(23)20-12-16-8-4-2-5-9-16/h2-11,18H,12-14H2,1H3,(H,20,23)(H,21,22)/t18-/m0/s1 |
| InChIKey | DAPJYTSZYCWKMO-SFHVURJKSA-N |
| XLogP | 3.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|