C13H18N2O3 — CID 45110082
(2R)-2-acetamido-N-benzyl-3-(trideuteriomethoxy)propanamide (PubChem CID 45110082) has the molecular formula C13H18N2O3 and a molecular weight of 253.32 g/mol. Its IUPAC name is (2R)-2-acetamido-N-benzyl-3-(trideuteriomethoxy)propanamide.
| Compound Name | (2R)-2-acetamido-N-benzyl-3-(trideuteriomethoxy)propanamide |
|---|---|
| PubChem CID | 45110082 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2R)-2-acetamido-N-benzyl-3-(trideuteriomethoxy)propanamide |
| SMILES | [2H]C([2H])([2H])OC[C@@H](NC(C)=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O3/c1-10(16)15-12(9-18-2)13(17)14-8-11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,14,17)(H,15,16)/t12-/m1/s1/i2D3 |
| InChIKey | VPPJLAIAVCUEMN-IBIJPGRPSA-N |
| XLogP | 0.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |