C15H23N3O3 — CID 10979254
(2S)-N-benzyl-2-[[2-(ethylamino)acetyl]amino]-3-methoxypropanamide (PubChem CID 10979254) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[[2-(ethylamino)acetyl]amino]-3-methoxypropanamide.
| Compound Name | (2S)-N-benzyl-2-[[2-(ethylamino)acetyl]amino]-3-methoxypropanamide |
|---|---|
| PubChem CID | 10979254 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | (2S)-N-benzyl-2-[[2-(ethylamino)acetyl]amino]-3-methoxypropanamide |
| SMILES | CCNCC(=O)N[C@@H](COC)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H23N3O3/c1-3-16-10-14(19)18-13(11-21-2)15(20)17-9-12-7-5-4-6-8-12/h4-8,13,16H,3,9-11H2,1-2H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | FSSPPCWTSLEHFW-ZDUSSCGKSA-N |
| XLogP | 0.04 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |