C16H23NO4 — CID 141445219
2-methylpropyl (2R)-3-(benzylamino)-2-(methoxymethyl)-3-oxopropanoate (PubChem CID 141445219) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-methylpropyl (2R)-3-(benzylamino)-2-(methoxymethyl)-3-oxopropanoate.
| Compound Name | 2-methylpropyl (2R)-3-(benzylamino)-2-(methoxymethyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 141445219 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-methylpropyl (2R)-3-(benzylamino)-2-(methoxymethyl)-3-oxopropanoate |
| SMILES | COC[C@H](C(=O)NCc1ccccc1)C(=O)OCC(C)C |
| InChI | InChI=1S/C16H23NO4/c1-12(2)10-21-16(19)14(11-20-3)15(18)17-9-13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | LIYLLKWZYJQHOT-CQSZACIVSA-N |
| XLogP | 1.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|