C14H17NO3S2 — CID 123713502
2-acetamido-3-(3-phenylpropanethioylsulfanyl)propanoic acid (PubChem CID 123713502) has the molecular formula C14H17NO3S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-acetamido-3-(3-phenylpropanethioylsulfanyl)propanoic acid.
| Compound Name | 2-acetamido-3-(3-phenylpropanethioylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 123713502 |
| Molecular Formula | C14H17NO3S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-acetamido-3-(3-phenylpropanethioylsulfanyl)propanoic acid |
| SMILES | CC(=O)NC(CSC(=S)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H17NO3S2/c1-10(16)15-12(14(17)18)9-20-13(19)8-7-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LFYPWWWNGQPGLQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|