C24H28K2N2O6S2 — CID 131882838
CID 131882838 (PubChem CID 131882838) has the molecular formula C24H28K2N2O6S2 and a molecular weight of 582.83 g/mol.
| Compound Name | CID 131882838 |
|---|---|
| PubChem CID | 131882838 |
| Molecular Formula | C24H28K2N2O6S2 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | — |
| SMILES | O=C(CCc1ccccc1)N[C@@H](CSSC[C@H](NC(=O)CCc1ccccc1)C(=O)O)C(=O)O.[K].[K] |
| InChI | InChI=1S/C24H28N2O6S2.2K/c27-21(13-11-17-7-3-1-4-8-17)25-19(23(29)30)15-33-34-16-20(24(31)32)26-22(28)14-12-18-9-5-2-6-10-18;;/h1-10,19-20H,11-16H2,(H,25,27)(H,26,28)(H,29,30)(H,31,32);;/t19-,20-;;/m0../s1 |
| InChIKey | CJZHBGONGFPUAA-TULUPMBKSA-N |
| XLogP | 2.01 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|