C12H22N2O6 — CID 107827213
(2R)-5-methoxy-2-(4-methoxybutylcarbamoylamino)-5-oxopentanoic acid (PubChem CID 107827213) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is (2R)-5-methoxy-2-(4-methoxybutylcarbamoylamino)-5-oxopentanoic acid.
| Compound Name | (2R)-5-methoxy-2-(4-methoxybutylcarbamoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107827213 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2R)-5-methoxy-2-(4-methoxybutylcarbamoylamino)-5-oxopentanoic acid |
| SMILES | COCCCCNC(=O)N[C@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C12H22N2O6/c1-19-8-4-3-7-13-12(18)14-9(11(16)17)5-6-10(15)20-2/h9H,3-8H2,1-2H3,(H,16,17)(H2,13,14,18)/t9-/m1/s1 |
| InChIKey | XDEBUKRBDWCSMM-SECBINFHSA-N |
| XLogP | 0.12 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|