C12H21N3O6 — CID 107828859
(2R)-2-[[3-(ethylamino)-3-oxopropyl]carbamoylamino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107828859) has the molecular formula C12H21N3O6 and a molecular weight of 303.32 g/mol. Its IUPAC name is (2R)-2-[[3-(ethylamino)-3-oxopropyl]carbamoylamino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[[3-(ethylamino)-3-oxopropyl]carbamoylamino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107828859 |
| Molecular Formula | C12H21N3O6 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2R)-2-[[3-(ethylamino)-3-oxopropyl]carbamoylamino]-5-methoxy-5-oxopentanoic acid |
| SMILES | CCNC(=O)CCNC(=O)N[C@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C12H21N3O6/c1-3-13-9(16)6-7-14-12(20)15-8(11(18)19)4-5-10(17)21-2/h8H,3-7H2,1-2H3,(H,13,16)(H,18,19)(H2,14,15,20)/t8-/m1/s1 |
| InChIKey | RWRZXEOTTCQXRX-MRVPVSSYSA-N |
| XLogP | -0.78 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |