C10H18N4O6 — CID 107828756
(2S)-2-[2-(carbamoylamino)ethylcarbamoylamino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107828756) has the molecular formula C10H18N4O6 and a molecular weight of 290.28 g/mol. Its IUPAC name is (2S)-2-[2-(carbamoylamino)ethylcarbamoylamino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[2-(carbamoylamino)ethylcarbamoylamino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107828756 |
| Molecular Formula | C10H18N4O6 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (2S)-2-[2-(carbamoylamino)ethylcarbamoylamino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)NCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H18N4O6/c1-20-7(15)3-2-6(8(16)17)14-10(19)13-5-4-12-9(11)18/h6H,2-5H2,1H3,(H,16,17)(H3,11,12,18)(H2,13,14,19)/t6-/m0/s1 |
| InChIKey | QEORGPKNRAUIBF-LURJTMIESA-N |
| XLogP | -1.64 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|