C13H24N2O6 — CID 107829264
(2R)-5-methoxy-2-[2-(2-methylpropoxy)ethylcarbamoylamino]-5-oxopentanoic acid (PubChem CID 107829264) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is (2R)-5-methoxy-2-[2-(2-methylpropoxy)ethylcarbamoylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-methoxy-2-[2-(2-methylpropoxy)ethylcarbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829264 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2R)-5-methoxy-2-[2-(2-methylpropoxy)ethylcarbamoylamino]-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)NCCOCC(C)C)C(=O)O |
| InChI | InChI=1S/C13H24N2O6/c1-9(2)8-21-7-6-14-13(19)15-10(12(17)18)4-5-11(16)20-3/h9-10H,4-8H2,1-3H3,(H,17,18)(H2,14,15,19)/t10-/m1/s1 |
| InChIKey | HDWQGJPSPVNGMG-SNVBAGLBSA-N |
| XLogP | 0.36 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|