C13H22N2O6 — CID 106404798
(2R)-2-(2-but-3-enoxyethylcarbamoylamino)-5-methoxy-5-oxopentanoic acid (PubChem CID 106404798) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-2-(2-but-3-enoxyethylcarbamoylamino)-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-(2-but-3-enoxyethylcarbamoylamino)-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 106404798 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2R)-2-(2-but-3-enoxyethylcarbamoylamino)-5-methoxy-5-oxopentanoic acid |
| SMILES | C=CCCOCCNC(=O)N[C@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C13H22N2O6/c1-3-4-8-21-9-7-14-13(19)15-10(12(17)18)5-6-11(16)20-2/h3,10H,1,4-9H2,2H3,(H,17,18)(H2,14,15,19)/t10-/m1/s1 |
| InChIKey | UPAWYKPRNKHFHF-SNVBAGLBSA-N |
| XLogP | 0.28 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|