C11H21N3O5 — CID 107826533
(2S)-5-methoxy-2-[3-(methylamino)propylcarbamoylamino]-5-oxopentanoic acid (PubChem CID 107826533) has the molecular formula C11H21N3O5 and a molecular weight of 275.30 g/mol. Its IUPAC name is (2S)-5-methoxy-2-[3-(methylamino)propylcarbamoylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-methoxy-2-[3-(methylamino)propylcarbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107826533 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2S)-5-methoxy-2-[3-(methylamino)propylcarbamoylamino]-5-oxopentanoic acid |
| SMILES | CNCCCNC(=O)N[C@@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C11H21N3O5/c1-12-6-3-7-13-11(18)14-8(10(16)17)4-5-9(15)19-2/h8,12H,3-7H2,1-2H3,(H,16,17)(H2,13,14,18)/t8-/m0/s1 |
| InChIKey | OUTMBARXWNYSHE-QMMMGPOBSA-N |
| XLogP | -0.70 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|