C16H26N2O6 — CID 59434222
2,6-bis(4-oxopentanoylamino)hexanoic acid (PubChem CID 59434222) has the molecular formula C16H26N2O6 and a molecular weight of 342.39 g/mol. Its IUPAC name is 2,6-bis(4-oxopentanoylamino)hexanoic acid.
| Compound Name | 2,6-bis(4-oxopentanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 59434222 |
| Molecular Formula | C16H26N2O6 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2,6-bis(4-oxopentanoylamino)hexanoic acid |
| SMILES | CC(=O)CCC(=O)NCCCCC(NC(=O)CCC(C)=O)C(=O)O |
| InChI | InChI=1S/C16H26N2O6/c1-11(19)6-8-14(21)17-10-4-3-5-13(16(23)24)18-15(22)9-7-12(2)20/h13H,3-10H2,1-2H3,(H,17,21)(H,18,22)(H,23,24) |
| InChIKey | XGGYGUMSABYEPJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|