C29H46N6O15S — CID 123581294
3-[[4-[[4-[(4-acetamido-4-carboxybutanoyl)amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-6-[[5-carboxy-5-(sulfanylamino)pentyl]amino]-6-oxohexanoic acid (PubChem CID 123581294) has the molecular formula C29H46N6O15S and a molecular weight of 750.78 g/mol. Its IUPAC name is 3-[[4-[[4-[(4-acetamido-4-carboxybutanoyl)amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-6-[[5-carboxy-5-(sulfanylamino)pentyl]amino]-6-oxohexanoic acid.
| Compound Name | 3-[[4-[[4-[(4-acetamido-4-carboxybutanoyl)amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-6-[[5-carboxy-5-(sulfanylamino)pentyl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 123581294 |
| Molecular Formula | C29H46N6O15S |
| Molecular Weight | 750.78 g/mol |
| Exact Mass | 750.27 |
| IUPAC Name | 3-[[4-[[4-[(4-acetamido-4-carboxybutanoyl)amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-6-[[5-carboxy-5-(sulfanylamino)pentyl]amino]-6-oxohexanoic acid |
| SMILES | CC(=O)NC(CCC(=O)NC(CCC(=O)NC(CCC(=O)NC(CCC(=O)NCCCCC(NS)C(=O)O)CC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C29H46N6O15S/c1-15(36)31-17(26(43)44)6-11-23(39)34-19(28(47)48)8-12-24(40)33-18(27(45)46)7-10-22(38)32-16(14-25(41)42)5-9-21(37)30-13-3-2-4-20(35-51)29(49)50/h16-20,35,51H,2-14H2,1H3,(H,30,37)(H,31,36)(H,32,38)(H,33,40)(H,34,39)(H,41,42)(H,43,44)(H,45,46)(H,47,48)(H,49,50) |
| InChIKey | RFSLCFIAALLXJS-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 344.03 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.78 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|