C32H52N6O14 — CID 123418902
2-acetamido-5-[[1-carboxy-4-[[1-carboxy-4-[[1-carboxy-4-oxo-4-[[6-oxo-5-(propylamino)heptyl]amino]butyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid (PubChem CID 123418902) has the molecular formula C32H52N6O14 and a molecular weight of 744.80 g/mol. Its IUPAC name is 2-acetamido-5-[[1-carboxy-4-[[1-carboxy-4-[[1-carboxy-4-oxo-4-[[6-oxo-5-(propylamino)heptyl]amino]butyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-acetamido-5-[[1-carboxy-4-[[1-carboxy-4-[[1-carboxy-4-oxo-4-[[6-oxo-5-(propylamino)heptyl]amino]butyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123418902 |
| Molecular Formula | C32H52N6O14 |
| Molecular Weight | 744.80 g/mol |
| Exact Mass | 744.35 |
| IUPAC Name | 2-acetamido-5-[[1-carboxy-4-[[1-carboxy-4-[[1-carboxy-4-oxo-4-[[6-oxo-5-(propylamino)heptyl]amino]butyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid |
| SMILES | CCCNC(CCCCNC(=O)CCC(NC(=O)CCC(NC(=O)CCC(NC(=O)CCC(NC(C)=O)C(=O)O)C(=O)O)C(=O)O)C(=O)O)C(C)=O |
| InChI | InChI=1S/C32H52N6O14/c1-4-16-33-20(18(2)39)7-5-6-17-34-25(41)12-8-22(30(47)48)36-27(43)14-10-24(32(51)52)38-28(44)15-11-23(31(49)50)37-26(42)13-9-21(29(45)46)35-19(3)40/h20-24,33H,4-17H2,1-3H3,(H,34,41)(H,35,40)(H,36,43)(H,37,42)(H,38,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | BLFLKJYCNNMADY-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 323.80 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.80 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|