C21H34N4O8 — CID 88990623
2-[[(4S)-4-acetamido-5-oxopentanoyl]amino]-5-[[(2S)-5-(butylamino)-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 88990623) has the molecular formula C21H34N4O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is 2-[[(4S)-4-acetamido-5-oxopentanoyl]amino]-5-[[(2S)-5-(butylamino)-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-[[(4S)-4-acetamido-5-oxopentanoyl]amino]-5-[[(2S)-5-(butylamino)-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 88990623 |
| Molecular Formula | C21H34N4O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 2-[[(4S)-4-acetamido-5-oxopentanoyl]amino]-5-[[(2S)-5-(butylamino)-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCCCNC(=O)CC[C@@H](C=O)NC(=O)CCC(NC(=O)CC[C@@H](C=O)NC(C)=O)C(=O)O |
| InChI | InChI=1S/C21H34N4O8/c1-3-4-11-22-18(29)8-5-16(13-27)24-19(30)10-7-17(21(32)33)25-20(31)9-6-15(12-26)23-14(2)28/h12-13,15-17H,3-11H2,1-2H3,(H,22,29)(H,23,28)(H,24,30)(H,25,31)(H,32,33)/t15-,16-,17?/m0/s1 |
| InChIKey | MKYXGLHCOSFADQ-PYNWJHIZSA-N |
| XLogP | -0.80 |
| TPSA | 187.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|