C26H41N5O11 — CID 88990702
2-acetamido-5-[[(2S)-5-[[4-[[(2S)-5-(butylamino)-1,5-dioxopentan-2-yl]amino]-1-carboxy-4-oxobutyl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 88990702) has the molecular formula C26H41N5O11 and a molecular weight of 599.64 g/mol. Its IUPAC name is 2-acetamido-5-[[(2S)-5-[[4-[[(2S)-5-(butylamino)-1,5-dioxopentan-2-yl]amino]-1-carboxy-4-oxobutyl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-acetamido-5-[[(2S)-5-[[4-[[(2S)-5-(butylamino)-1,5-dioxopentan-2-yl]amino]-1-carboxy-4-oxobutyl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 88990702 |
| Molecular Formula | C26H41N5O11 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | 2-acetamido-5-[[(2S)-5-[[4-[[(2S)-5-(butylamino)-1,5-dioxopentan-2-yl]amino]-1-carboxy-4-oxobutyl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCCCNC(=O)CC[C@@H](C=O)NC(=O)CCC(NC(=O)CC[C@@H](C=O)NC(=O)CCC(NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H41N5O11/c1-3-4-13-27-21(35)9-5-17(14-32)29-23(37)12-8-20(26(41)42)31-24(38)10-6-18(15-33)30-22(36)11-7-19(25(39)40)28-16(2)34/h14-15,17-20H,3-13H2,1-2H3,(H,27,35)(H,28,34)(H,29,37)(H,30,36)(H,31,38)(H,39,40)(H,41,42)/t17-,18-,19?,20?/m0/s1 |
| InChIKey | PSOXTKMHVYOBFV-VCAKUFKGSA-N |
| XLogP | -1.45 |
| TPSA | 254.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|