C18H31N3O6 — CID 144904902
2-(4-acetamidobutanoylamino)-5-[(5-methyl-4-oxohexyl)amino]-5-oxopentanoic acid (PubChem CID 144904902) has the molecular formula C18H31N3O6 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(4-acetamidobutanoylamino)-5-[(5-methyl-4-oxohexyl)amino]-5-oxopentanoic acid.
| Compound Name | 2-(4-acetamidobutanoylamino)-5-[(5-methyl-4-oxohexyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 144904902 |
| Molecular Formula | C18H31N3O6 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-(4-acetamidobutanoylamino)-5-[(5-methyl-4-oxohexyl)amino]-5-oxopentanoic acid |
| SMILES | CC(=O)NCCCC(=O)NC(CCC(=O)NCCCC(=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C18H31N3O6/c1-12(2)15(23)6-4-11-20-16(24)9-8-14(18(26)27)21-17(25)7-5-10-19-13(3)22/h12,14H,4-11H2,1-3H3,(H,19,22)(H,20,24)(H,21,25)(H,26,27) |
| InChIKey | IEVDOKDXWIHNSE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|