C17H29N3O7 — CID 123241911
2-acetamido-5-[[5-(1-carboxybutylamino)-5-oxopentyl]amino]-5-oxopentanoic acid (PubChem CID 123241911) has the molecular formula C17H29N3O7 and a molecular weight of 387.43 g/mol. Its IUPAC name is 2-acetamido-5-[[5-(1-carboxybutylamino)-5-oxopentyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-acetamido-5-[[5-(1-carboxybutylamino)-5-oxopentyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123241911 |
| Molecular Formula | C17H29N3O7 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-acetamido-5-[[5-(1-carboxybutylamino)-5-oxopentyl]amino]-5-oxopentanoic acid |
| SMILES | CCCC(NC(=O)CCCCNC(=O)CCC(NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H29N3O7/c1-3-6-12(16(24)25)20-15(23)7-4-5-10-18-14(22)9-8-13(17(26)27)19-11(2)21/h12-13H,3-10H2,1-2H3,(H,18,22)(H,19,21)(H,20,23)(H,24,25)(H,26,27) |
| InChIKey | BOBFOTJUICMXID-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|