C18H34N2O6 — CID 132936329
2,6-bis(6-hydroxyhexanoylamino)hexanoic acid (PubChem CID 132936329) has the molecular formula C18H34N2O6 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2,6-bis(6-hydroxyhexanoylamino)hexanoic acid.
| Compound Name | 2,6-bis(6-hydroxyhexanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 132936329 |
| Molecular Formula | C18H34N2O6 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2,6-bis(6-hydroxyhexanoylamino)hexanoic acid |
| SMILES | O=C(CCCCCO)NCCCCC(NC(=O)CCCCCO)C(=O)O |
| InChI | InChI=1S/C18H34N2O6/c21-13-7-1-3-10-16(23)19-12-6-5-9-15(18(25)26)20-17(24)11-4-2-8-14-22/h15,21-22H,1-14H2,(H,19,23)(H,20,24)(H,25,26) |
| InChIKey | IAACJWGCRHSKBS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|