C14H24N2O5 — CID 157474298
4-[(5-acetamido-6-oxooctyl)amino]-4-oxobutanoic acid (PubChem CID 157474298) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-[(5-acetamido-6-oxooctyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[(5-acetamido-6-oxooctyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 157474298 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 4-[(5-acetamido-6-oxooctyl)amino]-4-oxobutanoic acid |
| SMILES | CCC(=O)C(CCCCNC(=O)CCC(=O)O)NC(C)=O |
| InChI | InChI=1S/C14H24N2O5/c1-3-12(18)11(16-10(2)17)6-4-5-9-15-13(19)7-8-14(20)21/h11H,3-9H2,1-2H3,(H,15,19)(H,16,17)(H,20,21) |
| InChIKey | QVJPXXNAPYIMAK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|