C51H66N4O12 — CID 157474297
4-[(5-acetamido-6-oxooctyl)amino]-4-oxobutanoic acid;N-(5-acetamido-6-oxooctyl)-4-oxopentanamide;3',6'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 157474297) has the molecular formula C51H66N4O12 and a molecular weight of 927.10 g/mol. Its IUPAC name is 4-[(5-acetamido-6-oxooctyl)amino]-4-oxobutanoic acid;N-(5-acetamido-6-oxooctyl)-4-oxopentanamide;3',6'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 4-[(5-acetamido-6-oxooctyl)amino]-4-oxobutanoic acid;N-(5-acetamido-6-oxooctyl)-4-oxopentanamide;3',6'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 157474297 |
| Molecular Formula | C51H66N4O12 |
| Molecular Weight | 927.10 g/mol |
| Exact Mass | 926.47 |
| IUPAC Name | 4-[(5-acetamido-6-oxooctyl)amino]-4-oxobutanoic acid;N-(5-acetamido-6-oxooctyl)-4-oxopentanamide;3',6'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCC(=O)C(CCCCNC(=O)CCC(=O)O)NC(C)=O.CCC(=O)C(CCCCNC(=O)CCC(C)=O)NC(C)=O.Cc1ccc2c(c1)Oc1cc(C)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H16O3.C15H26N2O4.C14H24N2O5/c1-13-7-9-17-19(11-13)24-20-12-14(2)8-10-18(20)22(17)16-6-4-3-5-15(16)21(23)25-22;1-4-14(20)13(17-12(3)19)7-5-6-10-16-15(21)9-8-11(2)18;1-3-12(18)11(16-10(2)17)6-4-5-9-15-13(19)7-8-14(20)21/h3-12H,1-2H3;13H,4-10H2,1-3H3,(H,16,21)(H,17,19);11H,3-9H2,1-2H3,(H,15,19)(H,16,17)(H,20,21) |
| InChIKey | BVKDNYLRPIJMAJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 240.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.10 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|