C29H20O5S2 — CID 157215631
(6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) (benzyldisulfanyl)formate (PubChem CID 157215631) has the molecular formula C29H20O5S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is (6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) (benzyldisulfanyl)formate.
| Compound Name | (6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) (benzyldisulfanyl)formate |
|---|---|
| PubChem CID | 157215631 |
| Molecular Formula | C29H20O5S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | (6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) (benzyldisulfanyl)formate |
| SMILES | Cc1ccc2c(c1)Oc1cc(OC(=O)SSCc3ccccc3)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C29H20O5S2/c1-18-11-13-23-25(15-18)33-26-16-20(32-28(31)36-35-17-19-7-3-2-4-8-19)12-14-24(26)29(23)22-10-6-5-9-21(22)27(30)34-29/h2-16H,17H2,1H3 |
| InChIKey | ASJOYPCHEQQSCI-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|