C28H15O7PbS4 — CID 153370355
CID 153370355 (PubChem CID 153370355) has the molecular formula C28H15O7PbS4 and a molecular weight of 798.89 g/mol.
| Compound Name | CID 153370355 |
|---|---|
| PubChem CID | 153370355 |
| Molecular Formula | C28H15O7PbS4 |
| Molecular Weight | 798.89 g/mol |
| Exact Mass | 798.95 |
| IUPAC Name | — |
| SMILES | O=C(Oc1ccc2c(c1)Oc1cc(OC(=O)SSc3ccccc3)ccc1C21OC(=O)c2ccccc21)SS[Pb] |
| InChI | InChI=1S/C28H16O7S4.Pb/c29-25-19-8-4-5-9-20(19)28(35-25)21-12-10-16(32-26(30)37-36)14-23(21)34-24-15-17(11-13-22(24)28)33-27(31)39-38-18-6-2-1-3-7-18;/h1-15,36H;/q;+1/p-1 |
| InChIKey | FHSOLRJIOLBHHO-UHFFFAOYSA-M |
| XLogP | 8.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.89 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|