C27H20N2O6S — CID 87830871
3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;phenylsulfanylurea (PubChem CID 87830871) has the molecular formula C27H20N2O6S and a molecular weight of 500.53 g/mol. Its IUPAC name is 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;phenylsulfanylurea.
| Compound Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;phenylsulfanylurea |
|---|---|
| PubChem CID | 87830871 |
| Molecular Formula | C27H20N2O6S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;phenylsulfanylurea |
| SMILES | NC(=O)NSc1ccccc1.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C20H12O5.C7H8N2OS/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;8-7(10)9-11-6-4-2-1-3-5-6/h1-10,21-22H;1-5H,(H3,8,9,10) |
| InChIKey | OWRYNKQRRGBRIM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|